C13H21IN2O2 — CID 23622038
[4-(dimethylamino)-3-methylphenyl] N,N-dimethylcarbamate;iodomethane (PubChem CID 23622038) has the molecular formula C13H21IN2O2 and a molecular weight of 364.23 g/mol. Its IUPAC name is [4-(dimethylamino)-3-methylphenyl] N,N-dimethylcarbamate;iodomethane.
| Compound Name | [4-(dimethylamino)-3-methylphenyl] N,N-dimethylcarbamate;iodomethane |
|---|---|
| PubChem CID | 23622038 |
| Molecular Formula | C13H21IN2O2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [4-(dimethylamino)-3-methylphenyl] N,N-dimethylcarbamate;iodomethane |
| SMILES | CI.Cc1cc(OC(=O)N(C)C)ccc1N(C)C |
| InChI | InChI=1S/C12H18N2O2.CH3I/c1-9-8-10(16-12(15)14(4)5)6-7-11(9)13(2)3;1-2/h6-8H,1-5H3;1H3 |
| InChIKey | XLNHYHINEXEBME-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|