C18H30N2O2 — CID 23621908
[4-(dimethylamino)-3-heptylphenyl] N,N-dimethylcarbamate (PubChem CID 23621908) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is [4-(dimethylamino)-3-heptylphenyl] N,N-dimethylcarbamate.
| Compound Name | [4-(dimethylamino)-3-heptylphenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 23621908 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | [4-(dimethylamino)-3-heptylphenyl] N,N-dimethylcarbamate |
| SMILES | CCCCCCCc1cc(OC(=O)N(C)C)ccc1N(C)C |
| InChI | InChI=1S/C18H30N2O2/c1-6-7-8-9-10-11-15-14-16(22-18(21)20(4)5)12-13-17(15)19(2)3/h12-14H,6-11H2,1-5H3 |
| InChIKey | MRNZDDXNUUILDV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|