C17H17F2N3O2 — CID 171477783
6-cyclopropyl-N-[5,6-difluoro-4-(2-hydroxypropan-2-yl)-3-pyridinyl]pyridine-2-carboxamide (PubChem CID 171477783) has the molecular formula C17H17F2N3O2 and a molecular weight of 333.34 g/mol. Its IUPAC name is 6-cyclopropyl-N-[5,6-difluoro-4-(2-hydroxypropan-2-yl)-3-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 6-cyclopropyl-N-[5,6-difluoro-4-(2-hydroxypropan-2-yl)-3-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171477783 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 6-cyclopropyl-N-[5,6-difluoro-4-(2-hydroxypropan-2-yl)-3-pyridinyl]pyridine-2-carboxamide |
| SMILES | CC(C)(O)c1c(NC(=O)c2cccc(C3CC3)n2)cnc(F)c1F |
| InChI | InChI=1S/C17H17F2N3O2/c1-17(2,24)13-12(8-20-15(19)14(13)18)22-16(23)11-5-3-4-10(21-11)9-6-7-9/h3-5,8-9,24H,6-7H2,1-2H3,(H,22,23) |
| InChIKey | XYTAKSHCNWAERE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|