C25H44O — CID 171478133
1-[4-[(2R,4aR,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexyl]ethanone (PubChem CID 171478133) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is 1-[4-[(2R,4aR,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexyl]ethanone.
| Compound Name | 1-[4-[(2R,4aR,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 171478133 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | 1-[4-[(2R,4aR,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexyl]ethanone |
| SMILES | CCCCCCC[C@H]1CC[C@@H]2C[C@H](C3CCC(C(C)=O)CC3)CC[C@@H]2C1 |
| InChI | InChI=1S/C25H44O/c1-3-4-5-6-7-8-20-9-10-25-18-24(16-15-23(25)17-20)22-13-11-21(12-14-22)19(2)26/h20-25H,3-18H2,1-2H3/t20-,21?,22?,23+,24+,25+/m0/s1 |
| InChIKey | HDQZFEQAOCFORH-QJXLUHSYSA-N |
| XLogP | 7.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|