C26H46O — CID 56627518
1-[4-[(2R,4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexyl]propan-1-one (PubChem CID 56627518) has the molecular formula C26H46O and a molecular weight of 374.65 g/mol. Its IUPAC name is 1-[4-[(2R,4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexyl]propan-1-one.
| Compound Name | 1-[4-[(2R,4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexyl]propan-1-one |
|---|---|
| PubChem CID | 56627518 |
| Molecular Formula | C26H46O |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 374.35 |
| IUPAC Name | 1-[4-[(2R,4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]cyclohexyl]propan-1-one |
| SMILES | CCCCCCC[C@H]1CC[C@@H]2C[C@H](C3CCC(C(=O)CC)CC3)CC[C@H]2C1 |
| InChI | InChI=1S/C26H46O/c1-3-5-6-7-8-9-20-10-11-25-19-24(17-16-23(25)18-20)21-12-14-22(15-13-21)26(27)4-2/h20-25H,3-19H2,1-2H3/t20-,21?,22?,23-,24+,25+/m0/s1 |
| InChIKey | URNYHHIDYDSPRK-MVCPAHFRSA-N |
| XLogP | 7.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|