C16H30O — CID 139846520
6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol (PubChem CID 139846520) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol.
| Compound Name | 6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 139846520 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
| SMILES | CCCCCCC1CCC2CC(O)CCC2C1 |
| InChI | InChI=1S/C16H30O/c1-2-3-4-5-6-13-7-8-15-12-16(17)10-9-14(15)11-13/h13-17H,2-12H2,1H3 |
| InChIKey | KCMMFOPWVDMGLK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|