About 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine
7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine (PubChem CID 171481724) has the molecular formula C15H16N4O2
and a molecular weight of 284.32 g/mol. Its IUPAC name is 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 171481724 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine |
| SMILES | COc1ccc(CNc2ncc(OC)c3[nH]cnc23)cc1 |
| InChI | InChI=1S/C15H16N4O2/c1-20-11-5-3-10(4-6-11)7-16-15-14-13(18-9-19-14)12(21-2)8-17-15/h3-6,8-9H,7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | XQYGEHRCIPBCQW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine (CID 171481724) is 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine is COc1ccc(CNc2ncc(OC)c3[nH]cnc23)cc1.
What is the InChIKey of 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine?
The InChIKey is XQYGEHRCIPBCQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O2/c1-20-11-5-3-10(4-6-11)7-16-15-14-13(18-9-19-14)12(21-2)8-17-15/h3-6,8-9H,7H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine?
7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine has a molecular weight of 284.32 g/mol, XLogP of 2.59, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-N-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 171481724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).