C30H34N6O4S — CID 171481884
4-[3-(naphthalen-2-ylsulfonylamino)-4-(4-propan-2-ylpiperazin-1-yl)benzoyl]piperazine-1-carbonyl cyanide (PubChem CID 171481884) has the molecular formula C30H34N6O4S and a molecular weight of 574.71 g/mol. Its IUPAC name is 4-[3-(naphthalen-2-ylsulfonylamino)-4-(4-propan-2-ylpiperazin-1-yl)benzoyl]piperazine-1-carbonyl cyanide.
| Compound Name | 4-[3-(naphthalen-2-ylsulfonylamino)-4-(4-propan-2-ylpiperazin-1-yl)benzoyl]piperazine-1-carbonyl cyanide |
|---|---|
| PubChem CID | 171481884 |
| Molecular Formula | C30H34N6O4S |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 4-[3-(naphthalen-2-ylsulfonylamino)-4-(4-propan-2-ylpiperazin-1-yl)benzoyl]piperazine-1-carbonyl cyanide |
| SMILES | CC(C)N1CCN(c2ccc(C(=O)N3CCN(C(=O)C#N)CC3)cc2NS(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C30H34N6O4S/c1-22(2)33-11-13-34(14-12-33)28-10-8-25(30(38)36-17-15-35(16-18-36)29(37)21-31)20-27(28)32-41(39,40)26-9-7-23-5-3-4-6-24(23)19-26/h3-10,19-20,22,32H,11-18H2,1-2H3 |
| InChIKey | ZMSXXPMSIFIKIU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|