C9H16ClF3O6 — CID 171482355
(2R,3R,4S,5R)-6-chloro-7-fluoro-2,4-bis(fluoromethyl)heptane-1,2,3,4,5,6-hexol (PubChem CID 171482355) has the molecular formula C9H16ClF3O6 and a molecular weight of 312.67 g/mol. Its IUPAC name is (2R,3R,4S,5R)-6-chloro-7-fluoro-2,4-bis(fluoromethyl)heptane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4S,5R)-6-chloro-7-fluoro-2,4-bis(fluoromethyl)heptane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 171482355 |
| Molecular Formula | C9H16ClF3O6 |
| Molecular Weight | 312.67 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (2R,3R,4S,5R)-6-chloro-7-fluoro-2,4-bis(fluoromethyl)heptane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@](O)(CF)[C@@H](O)[C@@](O)(CF)[C@@H](O)C(O)(Cl)CF |
| InChI | InChI=1S/C9H16ClF3O6/c10-9(19,3-13)6(16)8(18,2-12)5(15)7(17,1-11)4-14/h5-6,14-19H,1-4H2/t5-,6-,7-,8+,9?/m1/s1 |
| InChIKey | IPJSWCPDKRWTSB-NBTWYFBKSA-N |
| XLogP | -2.00 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.67 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|