C15H28O3 — CID 171483623
1-(3,3-diethoxyprop-1-enyl)-4,4-dimethylcyclohexan-1-ol (PubChem CID 171483623) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-(3,3-diethoxyprop-1-enyl)-4,4-dimethylcyclohexan-1-ol.
| Compound Name | 1-(3,3-diethoxyprop-1-enyl)-4,4-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 171483623 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 1-(3,3-diethoxyprop-1-enyl)-4,4-dimethylcyclohexan-1-ol |
| SMILES | CCOC(C=CC1(O)CCC(C)(C)CC1)OCC |
| InChI | InChI=1S/C15H28O3/c1-5-17-13(18-6-2)7-8-15(16)11-9-14(3,4)10-12-15/h7-8,13,16H,5-6,9-12H2,1-4H3 |
| InChIKey | GJWAKIGLDXTBTQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|