C8H15BrO2 — CID 14179247
(E)-4-bromo-1,1-diethoxybut-2-ene (PubChem CID 14179247) has the molecular formula C8H15BrO2 and a molecular weight of 223.11 g/mol. Its IUPAC name is (E)-4-bromo-1,1-diethoxybut-2-ene.
| Compound Name | (E)-4-bromo-1,1-diethoxybut-2-ene |
|---|---|
| PubChem CID | 14179247 |
| Molecular Formula | C8H15BrO2 |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | (E)-4-bromo-1,1-diethoxybut-2-ene |
| SMILES | CCOC(/C=C/CBr)OCC |
| InChI | InChI=1S/C8H15BrO2/c1-3-10-8(11-4-2)6-5-7-9/h5-6,8H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | WRXRSIBAGAGYRY-AATRIKPKSA-N |
| XLogP | 2.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|