About (E)-4-bromo-1,1-diethoxybut-2-ene
(E)-4-bromo-1,1-diethoxybut-2-ene (PubChem CID 14179247) has the molecular formula C8H15BrO2
and a molecular weight of 223.11 g/mol. Its IUPAC name is (E)-4-bromo-1,1-diethoxybut-2-ene.
Molecular Properties
| Compound Name | (E)-4-bromo-1,1-diethoxybut-2-ene |
| PubChem CID | 14179247 |
| Molecular Formula | C8H15BrO2 |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | (E)-4-bromo-1,1-diethoxybut-2-ene |
| SMILES | CCOC(/C=C/CBr)OCC |
| InChI | InChI=1S/C8H15BrO2/c1-3-10-8(11-4-2)6-5-7-9/h5-6,8H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | WRXRSIBAGAGYRY-AATRIKPKSA-N |
| XLogP | 2.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-bromo-1,1-diethoxybut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-bromo-1,1-diethoxybut-2-ene?
The IUPAC name of (E)-4-bromo-1,1-diethoxybut-2-ene (CID 14179247) is (E)-4-bromo-1,1-diethoxybut-2-ene.
What is the SMILES notation for (E)-4-bromo-1,1-diethoxybut-2-ene?
The canonical SMILES for (E)-4-bromo-1,1-diethoxybut-2-ene is CCOC(/C=C/CBr)OCC.
What is the InChIKey of (E)-4-bromo-1,1-diethoxybut-2-ene?
The InChIKey is WRXRSIBAGAGYRY-AATRIKPKSA-N. The full InChI is InChI=1S/C8H15BrO2/c1-3-10-8(11-4-2)6-5-7-9/h5-6,8H,3-4,7H2,1-2H3/b6-5+.
What are the key properties of (E)-4-bromo-1,1-diethoxybut-2-ene?
(E)-4-bromo-1,1-diethoxybut-2-ene has a molecular weight of 223.11 g/mol, XLogP of 2.34, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-bromo-1,1-diethoxybut-2-ene is sourced from PubChem (CID 14179247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).