C14H24O2 — CID 87787384
(2E,4Z,7Z)-1,1-diethoxydeca-2,4,7-triene (PubChem CID 87787384) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (2E,4Z,7Z)-1,1-diethoxydeca-2,4,7-triene.
| Compound Name | (2E,4Z,7Z)-1,1-diethoxydeca-2,4,7-triene |
|---|---|
| PubChem CID | 87787384 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (2E,4Z,7Z)-1,1-diethoxydeca-2,4,7-triene |
| SMILES | CC/C=C\C/C=C\C=C\C(OCC)OCC |
| InChI | InChI=1S/C14H24O2/c1-4-7-8-9-10-11-12-13-14(15-5-2)16-6-3/h7-8,10-14H,4-6,9H2,1-3H3/b8-7-,11-10-,13-12+ |
| InChIKey | RCXRCZVXEUJNJV-YXVQMRFCSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|