C24H38O2 — CID 91034555
2-ethoxydocosa-4,7,10,13,16,19-hexaen-1-ol (PubChem CID 91034555) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is 2-ethoxydocosa-4,7,10,13,16,19-hexaen-1-ol.
| Compound Name | 2-ethoxydocosa-4,7,10,13,16,19-hexaen-1-ol |
|---|---|
| PubChem CID | 91034555 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 2-ethoxydocosa-4,7,10,13,16,19-hexaen-1-ol |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCC(CO)OCC |
| InChI | InChI=1S/C24H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(23-25)26-4-2/h5-6,8-9,11-12,14-15,17-18,20-21,24-25H,3-4,7,10,13,16,19,22-23H2,1-2H3 |
| InChIKey | MCQCKDDWJGZUIU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|