C10H21O2P — CID 175489777
[(E)-6,6-diethoxyhex-4-enyl]phosphane (PubChem CID 175489777) has the molecular formula C10H21O2P and a molecular weight of 204.25 g/mol. Its IUPAC name is [(E)-6,6-diethoxyhex-4-enyl]phosphane.
| Compound Name | [(E)-6,6-diethoxyhex-4-enyl]phosphane |
|---|---|
| PubChem CID | 175489777 |
| Molecular Formula | C10H21O2P |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | [(E)-6,6-diethoxyhex-4-enyl]phosphane |
| SMILES | CCOC(/C=C/CCCP)OCC |
| InChI | InChI=1S/C10H21O2P/c1-3-11-10(12-4-2)8-6-5-7-9-13/h6,8,10H,3-5,7,9,13H2,1-2H3/b8-6+ |
| InChIKey | ACQFSOREFHHPAV-SOFGYWHQSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|