C9H18O4 — CID 154116417
2-(3,3-diethoxyprop-1-enoxy)ethanol (PubChem CID 154116417) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(3,3-diethoxyprop-1-enoxy)ethanol.
| Compound Name | 2-(3,3-diethoxyprop-1-enoxy)ethanol |
|---|---|
| PubChem CID | 154116417 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-(3,3-diethoxyprop-1-enoxy)ethanol |
| SMILES | CCOC(C=COCCO)OCC |
| InChI | InChI=1S/C9H18O4/c1-3-12-9(13-4-2)5-7-11-8-6-10/h5,7,9-10H,3-4,6,8H2,1-2H3 |
| InChIKey | JFRJMHPBKPVDGE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|