C22H16BrN5S — CID 171483743
4-(3-bromophenyl)-N-[(E)-(9-methylpyrido[3,4-b]indol-3-yl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 171483743) has the molecular formula C22H16BrN5S and a molecular weight of 462.38 g/mol. Its IUPAC name is 4-(3-bromophenyl)-N-[(E)-(9-methylpyrido[3,4-b]indol-3-yl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(3-bromophenyl)-N-[(E)-(9-methylpyrido[3,4-b]indol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 171483743 |
| Molecular Formula | C22H16BrN5S |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 4-(3-bromophenyl)-N-[(E)-(9-methylpyrido[3,4-b]indol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cn1c2ccccc2c2cc(/C=N/Nc3nc(-c4cccc(Br)c4)cs3)ncc21 |
| InChI | InChI=1S/C22H16BrN5S/c1-28-20-8-3-2-7-17(20)18-10-16(24-12-21(18)28)11-25-27-22-26-19(13-29-22)14-5-4-6-15(23)9-14/h2-13H,1H3,(H,26,27)/b25-11+ |
| InChIKey | MXXXTMKYZKNDLC-OPEKNORGSA-N |
| XLogP | 6.06 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|