C23H17FN4S — CID 155539204
4-(3-fluorophenyl)-N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 155539204) has the molecular formula C23H17FN4S and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(3-fluorophenyl)-N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155539204 |
| Molecular Formula | C23H17FN4S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-(3-fluorophenyl)-N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cn1c2ccccc2c2cc(/C=N/Nc3nc(-c4cccc(F)c4)cs3)ccc21 |
| InChI | InChI=1S/C23H17FN4S/c1-28-21-8-3-2-7-18(21)19-11-15(9-10-22(19)28)13-25-27-23-26-20(14-29-23)16-5-4-6-17(24)12-16/h2-14H,1H3,(H,26,27)/b25-13+ |
| InChIKey | ANZYHMUBCBXCEF-DHRITJCHSA-N |
| XLogP | 6.04 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|