C15H22O4 — CID 171485491
1,3-dimethoxypropan-2-yl 2-propan-2-ylbenzoate (PubChem CID 171485491) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,3-dimethoxypropan-2-yl 2-propan-2-ylbenzoate.
| Compound Name | 1,3-dimethoxypropan-2-yl 2-propan-2-ylbenzoate |
|---|---|
| PubChem CID | 171485491 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1,3-dimethoxypropan-2-yl 2-propan-2-ylbenzoate |
| SMILES | COCC(COC)OC(=O)c1ccccc1C(C)C |
| InChI | InChI=1S/C15H22O4/c1-11(2)13-7-5-6-8-14(13)15(16)19-12(9-17-3)10-18-4/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | PRGRQMLDVZCZLR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |