C14H19ClO4 — CID 171485500
[2-(2-chlorophenyl)-1,3-diethoxypropyl] formate (PubChem CID 171485500) has the molecular formula C14H19ClO4 and a molecular weight of 286.75 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1,3-diethoxypropyl] formate.
| Compound Name | [2-(2-chlorophenyl)-1,3-diethoxypropyl] formate |
|---|---|
| PubChem CID | 171485500 |
| Molecular Formula | C14H19ClO4 |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [2-(2-chlorophenyl)-1,3-diethoxypropyl] formate |
| SMILES | CCOCC(c1ccccc1Cl)C(OC=O)OCC |
| InChI | InChI=1S/C14H19ClO4/c1-3-17-9-12(14(18-4-2)19-10-16)11-7-5-6-8-13(11)15/h5-8,10,12,14H,3-4,9H2,1-2H3 |
| InChIKey | BOOJCXPGWVBHLY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|