C51H95NO6S2 — CID 171487392
[2,14-bis(3-cyclohexylpropanoyloxy)-1,15-bis(hexylsulfanyl)pentadecan-8-yl] 4-(dimethylamino)butanoate (PubChem CID 171487392) has the molecular formula C51H95NO6S2 and a molecular weight of 882.46 g/mol. Its IUPAC name is [2,14-bis(3-cyclohexylpropanoyloxy)-1,15-bis(hexylsulfanyl)pentadecan-8-yl] 4-(dimethylamino)butanoate.
| Compound Name | [2,14-bis(3-cyclohexylpropanoyloxy)-1,15-bis(hexylsulfanyl)pentadecan-8-yl] 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 171487392 |
| Molecular Formula | C51H95NO6S2 |
| Molecular Weight | 882.46 g/mol |
| Exact Mass | 881.66 |
| IUPAC Name | [2,14-bis(3-cyclohexylpropanoyloxy)-1,15-bis(hexylsulfanyl)pentadecan-8-yl] 4-(dimethylamino)butanoate |
| SMILES | CCCCCCSCC(CCCCCC(CCCCCC(CSCCCCCC)OC(=O)CCC1CCCCC1)OC(=O)CCCN(C)C)OC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C51H95NO6S2/c1-5-7-9-23-40-59-42-47(57-50(54)37-35-44-26-15-11-16-27-44)32-21-13-19-30-46(56-49(53)34-25-39-52(3)4)31-20-14-22-33-48(43-60-41-24-10-8-6-2)58-51(55)38-36-45-28-17-12-18-29-45/h44-48H,5-43H2,1-4H3 |
| InChIKey | RZZPMPCXEFSVLR-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.46 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|