C44H83NO4S2 — CID 178079159
[8-cyclohexyl-1-[5-[5-(2-propanoyloxyoctylsulfanyl)pentylamino]pentylsulfanyl]octan-2-yl] 3-cyclohexylpropanoate (PubChem CID 178079159) has the molecular formula C44H83NO4S2 and a molecular weight of 754.28 g/mol. Its IUPAC name is [8-cyclohexyl-1-[5-[5-(2-propanoyloxyoctylsulfanyl)pentylamino]pentylsulfanyl]octan-2-yl] 3-cyclohexylpropanoate.
| Compound Name | [8-cyclohexyl-1-[5-[5-(2-propanoyloxyoctylsulfanyl)pentylamino]pentylsulfanyl]octan-2-yl] 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 178079159 |
| Molecular Formula | C44H83NO4S2 |
| Molecular Weight | 754.28 g/mol |
| Exact Mass | 753.58 |
| IUPAC Name | [8-cyclohexyl-1-[5-[5-(2-propanoyloxyoctylsulfanyl)pentylamino]pentylsulfanyl]octan-2-yl] 3-cyclohexylpropanoate |
| SMILES | CCCCCCC(CSCCCCCNCCCCCSCC(CCCCCCC1CCCCC1)OC(=O)CCC1CCCCC1)OC(=O)CC |
| InChI | InChI=1S/C44H83NO4S2/c1-3-5-6-18-29-41(48-43(46)4-2)37-50-35-22-11-20-33-45-34-21-12-23-36-51-38-42(49-44(47)32-31-40-27-16-10-17-28-40)30-19-8-7-13-24-39-25-14-9-15-26-39/h39-42,45H,3-38H2,1-2H3 |
| InChIKey | ZWVHZOUVDNJLMB-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.28 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|