C11H9N5O2 — CID 171487720
methyl 7-amino-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-12-carboxylate (PubChem CID 171487720) has the molecular formula C11H9N5O2 and a molecular weight of 243.23 g/mol. Its IUPAC name is methyl 7-amino-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-12-carboxylate.
| Compound Name | methyl 7-amino-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 171487720 |
| Molecular Formula | C11H9N5O2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | methyl 7-amino-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-12-carboxylate |
| SMILES | COC(=O)c1ccc2nc(N)c3cncn3c2n1 |
| InChI | InChI=1S/C11H9N5O2/c1-18-11(17)7-3-2-6-10(15-7)16-5-13-4-8(16)9(12)14-6/h2-5H,1H3,(H2,12,14) |
| InChIKey | HRNONTYDHSSIAJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |