C33H39NO6 — CID 171489317
(2,2,6,6-tetramethyloxan-4-yl) (4S,7R)-4-(3-hydroxyphenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 171489317) has the molecular formula C33H39NO6 and a molecular weight of 545.68 g/mol. Its IUPAC name is (2,2,6,6-tetramethyloxan-4-yl) (4S,7R)-4-(3-hydroxyphenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | (2,2,6,6-tetramethyloxan-4-yl) (4S,7R)-4-(3-hydroxyphenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 171489317 |
| Molecular Formula | C33H39NO6 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | (2,2,6,6-tetramethyloxan-4-yl) (4S,7R)-4-(3-hydroxyphenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccccc1[C@H]1CC(=O)C2=C(C1)NC(C)=C(C(=O)OC1CC(C)(C)OC(C)(C)C1)[C@H]2c1cccc(O)c1 |
| InChI | InChI=1S/C33H39NO6/c1-19-28(31(37)39-23-17-32(2,3)40-33(4,5)18-23)29(20-10-9-11-22(35)14-20)30-25(34-19)15-21(16-26(30)36)24-12-7-8-13-27(24)38-6/h7-14,21,23,29,34-35H,15-18H2,1-6H3/t21-,29-/m1/s1 |
| InChIKey | ANNPNHAWDRMZPW-ONOMSOESSA-N |
| XLogP | 6.04 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |