C16H12F8N6OS — CID 171490752
N-[4-ethylsulfanyl-1-methyl-3-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyrazol-5-yl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 171490752) has the molecular formula C16H12F8N6OS and a molecular weight of 488.36 g/mol. Its IUPAC name is N-[4-ethylsulfanyl-1-methyl-3-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyrazol-5-yl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[4-ethylsulfanyl-1-methyl-3-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyrazol-5-yl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 171490752 |
| Molecular Formula | C16H12F8N6OS |
| Molecular Weight | 488.36 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | N-[4-ethylsulfanyl-1-methyl-3-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyrazol-5-yl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CCSc1c(-c2nc3cc(C(F)(F)F)ccn3n2)nn(C)c1NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H12F8N6OS/c1-3-32-10-9(11-25-8-6-7(15(19,20)21)4-5-30(8)28-11)27-29(2)12(10)26-13(31)14(17,18)16(22,23)24/h4-6H,3H2,1-2H3,(H,26,31) |
| InChIKey | BSJXATSMULIZFU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|