C21H22F3N5O3S2 — CID 167201939
(E)-1-cyclopropyl-1-[5-ethylsulfonyl-6-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-pyridinyl]-N-(2-methylsulfanylethoxy)methanimine (PubChem CID 167201939) has the molecular formula C21H22F3N5O3S2 and a molecular weight of 513.57 g/mol. Its IUPAC name is (E)-1-cyclopropyl-1-[5-ethylsulfonyl-6-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-pyridinyl]-N-(2-methylsulfanylethoxy)methanimine.
| Compound Name | (E)-1-cyclopropyl-1-[5-ethylsulfonyl-6-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-pyridinyl]-N-(2-methylsulfanylethoxy)methanimine |
|---|---|
| PubChem CID | 167201939 |
| Molecular Formula | C21H22F3N5O3S2 |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | (E)-1-cyclopropyl-1-[5-ethylsulfonyl-6-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-pyridinyl]-N-(2-methylsulfanylethoxy)methanimine |
| SMILES | CCS(=O)(=O)c1cc(/C(=N/OCCSC)C2CC2)cnc1-c1nc2cc(C(F)(F)F)ccn2n1 |
| InChI | InChI=1S/C21H22F3N5O3S2/c1-3-34(30,31)16-10-14(18(13-4-5-13)28-32-8-9-33-2)12-25-19(16)20-26-17-11-15(21(22,23)24)6-7-29(17)27-20/h6-7,10-13H,3-5,8-9H2,1-2H3/b28-18+ |
| InChIKey | QLOPHVZYJNNAEZ-MTDXEUNCSA-N |
| XLogP | 4.10 |
| TPSA | 98.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|