C27H33N5O4 — CID 171491543
3-[7-[[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171491543) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is 3-[7-[[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171491543 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 3-[7-[[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCc1cc(N)c(OC)cc1N1CCC(Nc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C27H33N5O4/c1-3-16-13-20(28)24(36-2)14-23(16)31-11-9-17(10-12-31)29-21-6-4-5-18-19(21)15-32(27(18)35)22-7-8-25(33)30-26(22)34/h4-6,13-14,17,22,29H,3,7-12,15,28H2,1-2H3,(H,30,33,34) |
| InChIKey | ZGTOCJVSUJYLOV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|