C11H17F2N — CID 171492754
(E)-2-(1,1-difluoroethyl)-N-[(Z)-pent-2-en-2-yl]but-2-en-1-imine (PubChem CID 171492754) has the molecular formula C11H17F2N and a molecular weight of 201.26 g/mol. Its IUPAC name is (E)-2-(1,1-difluoroethyl)-N-[(Z)-pent-2-en-2-yl]but-2-en-1-imine.
| Compound Name | (E)-2-(1,1-difluoroethyl)-N-[(Z)-pent-2-en-2-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 171492754 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | (E)-2-(1,1-difluoroethyl)-N-[(Z)-pent-2-en-2-yl]but-2-en-1-imine |
| SMILES | C/C=C(\C=N\C(C)=C/CC)C(C)(F)F |
| InChI | InChI=1S/C11H17F2N/c1-5-7-9(3)14-8-10(6-2)11(4,12)13/h6-8H,5H2,1-4H3/b9-7-,10-6+,14-8+ |
| InChIKey | QCKNLBGQXZAQAW-FWCRAVKBSA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|