C19H15ClN6O — CID 171495483
2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 171495483) has the molecular formula C19H15ClN6O and a molecular weight of 378.82 g/mol. Its IUPAC name is 2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 171495483 |
| Molecular Formula | C19H15ClN6O |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | NC(=O)c1cnc2c(c1)nc(-c1cccnc1N)n2-c1ccc(CCl)cc1 |
| InChI | InChI=1S/C19H15ClN6O/c20-9-11-3-5-13(6-4-11)26-18(14-2-1-7-23-16(14)21)25-15-8-12(17(22)27)10-24-19(15)26/h1-8,10H,9H2,(H2,21,23)(H2,22,27) |
| InChIKey | YJURVNZEPLYTOG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|