C18H24F3NO — CID 171496798
1-[5-ethenyl-4-[(3E,5E)-7,7,7-trifluoro-3,6-dimethylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran-6-yl]-N-methylmethanamine (PubChem CID 171496798) has the molecular formula C18H24F3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-[5-ethenyl-4-[(3E,5E)-7,7,7-trifluoro-3,6-dimethylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran-6-yl]-N-methylmethanamine.
| Compound Name | 1-[5-ethenyl-4-[(3E,5E)-7,7,7-trifluoro-3,6-dimethylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran-6-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 171496798 |
| Molecular Formula | C18H24F3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-[5-ethenyl-4-[(3E,5E)-7,7,7-trifluoro-3,6-dimethylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran-6-yl]-N-methylmethanamine |
| SMILES | C=CC1=C(C(=C)/C(C)=C/C=C(\C)C(F)(F)F)CCOC1CNC |
| InChI | InChI=1S/C18H24F3NO/c1-6-15-16(9-10-23-17(15)11-22-5)14(4)12(2)7-8-13(3)18(19,20)21/h6-8,17,22H,1,4,9-11H2,2-3,5H3/b12-7+,13-8+ |
| InChIKey | YHVIIHUONJCJKE-INOXDZRUSA-N |
| XLogP | 4.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|