C19H26F3NO — CID 171496590
1-[5-ethenyl-4-[(3E,5E)-3-ethyl-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran-6-yl]-N-methylmethanamine (PubChem CID 171496590) has the molecular formula C19H26F3NO and a molecular weight of 341.42 g/mol. Its IUPAC name is 1-[5-ethenyl-4-[(3E,5E)-3-ethyl-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran-6-yl]-N-methylmethanamine.
| Compound Name | 1-[5-ethenyl-4-[(3E,5E)-3-ethyl-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran-6-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 171496590 |
| Molecular Formula | C19H26F3NO |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1-[5-ethenyl-4-[(3E,5E)-3-ethyl-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran-6-yl]-N-methylmethanamine |
| SMILES | C=CC1=C(C(=C)/C(=C/C=C(\C)C(F)(F)F)CC)CCOC1CNC |
| InChI | InChI=1S/C19H26F3NO/c1-6-15(9-8-13(3)19(20,21)22)14(4)17-10-11-24-18(12-23-5)16(17)7-2/h7-9,18,23H,2,4,6,10-12H2,1,3,5H3/b13-8+,15-9+ |
| InChIKey | FSQZXZCABJQYSH-TVXJZBATSA-N |
| XLogP | 4.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|