About 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile
1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 171497514) has the molecular formula C12H12FN
and a molecular weight of 189.23 g/mol. Its IUPAC name is 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile.
Analyze 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile?
The IUPAC name of 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile (CID 171497514) is 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile.
What is the SMILES notation for 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile?
The canonical SMILES for 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile is CCC1CCc2cc(C#N)cc(F)c21.
What is the InChIKey of 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile?
The InChIKey is GPUGPQMZCHJIAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN/c1-2-9-3-4-10-5-8(7-14)6-11(13)12(9)10/h5-6,9H,2-4H2,1H3.
What are the key properties of 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile?
1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile has a molecular weight of 189.23 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-7-fluoro-2,3-dihydro-1H-indene-5-carbonitrile is sourced from PubChem (CID 171497514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).