C16H20F2N2 — CID 107038168
4-[[(4-ethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile (PubChem CID 107038168) has the molecular formula C16H20F2N2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 4-[[(4-ethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[[(4-ethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 107038168 |
| Molecular Formula | C16H20F2N2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 4-[[(4-ethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile |
| SMILES | CCC1CCC(NCc2c(F)cc(C#N)cc2F)CC1 |
| InChI | InChI=1S/C16H20F2N2/c1-2-11-3-5-13(6-4-11)20-10-14-15(17)7-12(9-19)8-16(14)18/h7-8,11,13,20H,2-6,10H2,1H3 |
| InChIKey | GVAIPRNXFLPHBM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |