C14H16F2N2O — CID 107037997
3,5-difluoro-4-[[(3-hydroxycyclohexyl)amino]methyl]benzonitrile (PubChem CID 107037997) has the molecular formula C14H16F2N2O and a molecular weight of 266.29 g/mol. Its IUPAC name is 3,5-difluoro-4-[[(3-hydroxycyclohexyl)amino]methyl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[[(3-hydroxycyclohexyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 107037997 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3,5-difluoro-4-[[(3-hydroxycyclohexyl)amino]methyl]benzonitrile |
| SMILES | N#Cc1cc(F)c(CNC2CCCC(O)C2)c(F)c1 |
| InChI | InChI=1S/C14H16F2N2O/c15-13-4-9(7-17)5-14(16)12(13)8-18-10-2-1-3-11(19)6-10/h4-5,10-11,18-19H,1-3,6,8H2 |
| InChIKey | QKOVQPFWFOOYPB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |