About 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile
4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile (PubChem CID 107038446) has the molecular formula C16H20F2N2
and a molecular weight of 278.35 g/mol. Its IUPAC name is 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile |
| PubChem CID | 107038446 |
| Molecular Formula | C16H20F2N2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile |
| SMILES | CC1(C)CCC(NCc2c(F)cc(C#N)cc2F)CC1 |
| InChI | InChI=1S/C16H20F2N2/c1-16(2)5-3-12(4-6-16)20-10-13-14(17)7-11(9-19)8-15(13)18/h7-8,12,20H,3-6,10H2,1-2H3 |
| InChIKey | VJQKCTJSHTXQFQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile?
The IUPAC name of 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile (CID 107038446) is 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile?
The canonical SMILES for 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile is CC1(C)CCC(NCc2c(F)cc(C#N)cc2F)CC1.
What is the InChIKey of 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile?
The InChIKey is VJQKCTJSHTXQFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F2N2/c1-16(2)5-3-12(4-6-16)20-10-13-14(17)7-11(9-19)8-15(13)18/h7-8,12,20H,3-6,10H2,1-2H3.
What are the key properties of 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile?
4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile has a molecular weight of 278.35 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4,4-dimethylcyclohexyl)amino]methyl]-3,5-difluorobenzonitrile is sourced from PubChem (CID 107038446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).