C14H14F2N2 — CID 107038543
4-[(cyclohex-3-en-1-ylamino)methyl]-3,5-difluorobenzonitrile (PubChem CID 107038543) has the molecular formula C14H14F2N2 and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-[(cyclohex-3-en-1-ylamino)methyl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[(cyclohex-3-en-1-ylamino)methyl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 107038543 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-[(cyclohex-3-en-1-ylamino)methyl]-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(CNC2CC=CCC2)c(F)c1 |
| InChI | InChI=1S/C14H14F2N2/c15-13-6-10(8-17)7-14(16)12(13)9-18-11-4-2-1-3-5-11/h1-2,6-7,11,18H,3-5,9H2 |
| InChIKey | BSRWUXQUKOXLCM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|