C18H17ClF3N3O2 — CID 171499203
5-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]-2-fluoro-N-methylbenzamide (PubChem CID 171499203) has the molecular formula C18H17ClF3N3O2 and a molecular weight of 399.80 g/mol. Its IUPAC name is 5-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]-2-fluoro-N-methylbenzamide.
| Compound Name | 5-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 171499203 |
| Molecular Formula | C18H17ClF3N3O2 |
| Molecular Weight | 399.80 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 5-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]-2-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(-c2cc([C@@H]3COC[C@@H](C(F)F)N3)cc(Cl)n2)ccc1F |
| InChI | InChI=1S/C18H17ClF3N3O2/c1-23-18(26)11-4-9(2-3-12(11)20)13-5-10(6-16(19)25-13)14-7-27-8-15(24-14)17(21)22/h2-6,14-15,17,24H,7-8H2,1H3,(H,23,26)/t14-,15-/m0/s1 |
| InChIKey | RWIKYPWTTBOMCZ-GJZGRUSLSA-N |
| XLogP | 3.20 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.80 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|