C17H15ClF3N3O2 — CID 171499854
5-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]-2-fluorobenzamide (PubChem CID 171499854) has the molecular formula C17H15ClF3N3O2 and a molecular weight of 385.77 g/mol. Its IUPAC name is 5-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 171499854 |
| Molecular Formula | C17H15ClF3N3O2 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 5-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cc([C@@H]3COC[C@@H](C(F)F)N3)cc(Cl)n2)ccc1F |
| InChI | InChI=1S/C17H15ClF3N3O2/c18-15-5-9(13-6-26-7-14(23-13)16(20)21)4-12(24-15)8-1-2-11(19)10(3-8)17(22)25/h1-5,13-14,16,23H,6-7H2,(H2,22,25)/t13-,14-/m0/s1 |
| InChIKey | LSUBGDDVNJXMDM-KBPBESRZSA-N |
| XLogP | 2.93 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|