C23H17F2N3O5S — CID 171501349
N-(4,4-difluoro-1-oxo-2,3-dihydrothiochromen-8-yl)-N-[(4-formyl-3-nitrophenyl)methyl]pyridine-3-carboxamide (PubChem CID 171501349) has the molecular formula C23H17F2N3O5S and a molecular weight of 485.47 g/mol. Its IUPAC name is N-(4,4-difluoro-1-oxo-2,3-dihydrothiochromen-8-yl)-N-[(4-formyl-3-nitrophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | N-(4,4-difluoro-1-oxo-2,3-dihydrothiochromen-8-yl)-N-[(4-formyl-3-nitrophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171501349 |
| Molecular Formula | C23H17F2N3O5S |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-(4,4-difluoro-1-oxo-2,3-dihydrothiochromen-8-yl)-N-[(4-formyl-3-nitrophenyl)methyl]pyridine-3-carboxamide |
| SMILES | O=Cc1ccc(CN(C(=O)c2cccnc2)c2cccc3c2S(=O)CCC3(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H17F2N3O5S/c24-23(25)8-10-34(33)21-18(23)4-1-5-19(21)27(22(30)16-3-2-9-26-12-16)13-15-6-7-17(14-29)20(11-15)28(31)32/h1-7,9,11-12,14H,8,10,13H2 |
| InChIKey | KELXNJKBLNTZFC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 110.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|