C22H18N4O4S — CID 171501694
N-[(6-ethenyl-5-nitro-3-pyridinyl)methyl]-N-(1-oxo-2,3-dihydro-1-benzothiophen-7-yl)pyridine-3-carboxamide (PubChem CID 171501694) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is N-[(6-ethenyl-5-nitro-3-pyridinyl)methyl]-N-(1-oxo-2,3-dihydro-1-benzothiophen-7-yl)pyridine-3-carboxamide.
| Compound Name | N-[(6-ethenyl-5-nitro-3-pyridinyl)methyl]-N-(1-oxo-2,3-dihydro-1-benzothiophen-7-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171501694 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-[(6-ethenyl-5-nitro-3-pyridinyl)methyl]-N-(1-oxo-2,3-dihydro-1-benzothiophen-7-yl)pyridine-3-carboxamide |
| SMILES | C=Cc1ncc(CN(C(=O)c2cccnc2)c2cccc3c2S(=O)CC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18N4O4S/c1-2-18-20(26(28)29)11-15(12-24-18)14-25(22(27)17-6-4-9-23-13-17)19-7-3-5-16-8-10-31(30)21(16)19/h2-7,9,11-13H,1,8,10,14H2 |
| InChIKey | RFUAOHIQSVLFQB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 106.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|