C22H18N4O4S — CID 40983020
N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-nitro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 40983020) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-nitro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-nitro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 40983020 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-nitro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCOc1ccc2nc(N(Cc3cccnc3)C(=O)c3ccccc3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C22H18N4O4S/c1-2-30-16-9-10-18-20(12-16)31-22(24-18)25(14-15-6-5-11-23-13-15)21(27)17-7-3-4-8-19(17)26(28)29/h3-13H,2,14H2,1H3 |
| InChIKey | VCZJOGMBDIKBKO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|