C24H22N4O6S — CID 43967295
N-(6-ethoxy-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 43967295) has the molecular formula C24H22N4O6S and a molecular weight of 494.53 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43967295 |
| Molecular Formula | C24H22N4O6S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCOc1ccc2nc(N(Cc3cccnc3)C(=O)c3cc(OC)c(OC)cc3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C24H22N4O6S/c1-4-34-16-7-8-18-22(10-16)35-24(26-18)27(14-15-6-5-9-25-13-15)23(29)17-11-20(32-2)21(33-3)12-19(17)28(30)31/h5-13H,4,14H2,1-3H3 |
| InChIKey | YKGUSTRBGKBKPI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 116.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|