C22H17ClN4O5S — CID 43966242
5-chloro-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-nitro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 43966242) has the molecular formula C22H17ClN4O5S and a molecular weight of 484.92 g/mol. Its IUPAC name is 5-chloro-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-nitro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-chloro-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-nitro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43966242 |
| Molecular Formula | C22H17ClN4O5S |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 5-chloro-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-nitro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | COc1cc2nc(N(Cc3cccnc3)C(=O)c3cc(Cl)ccc3[N+](=O)[O-])sc2cc1OC |
| InChI | InChI=1S/C22H17ClN4O5S/c1-31-18-9-16-20(10-19(18)32-2)33-22(25-16)26(12-13-4-3-7-24-11-13)21(28)15-8-14(23)5-6-17(15)27(29)30/h3-11H,12H2,1-2H3 |
| InChIKey | FPEJMIJPJWIVJM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|