C21H24N4O4S — CID 43961190
N-[2-(dimethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-methyl-3-nitrobenzamide (PubChem CID 43961190) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-methyl-3-nitrobenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43961190 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-methyl-3-nitrobenzamide |
| SMILES | CCOc1ccc2nc(N(CCN(C)C)C(=O)c3cccc([N+](=O)[O-])c3C)sc2c1 |
| InChI | InChI=1S/C21H24N4O4S/c1-5-29-15-9-10-17-19(13-15)30-21(22-17)24(12-11-23(3)4)20(26)16-7-6-8-18(14(16)2)25(27)28/h6-10,13H,5,11-12H2,1-4H3 |
| InChIKey | NDRIEZQNKMMWNB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|