C19H21N4O4S+ — CID 7507376
2-[(6-methoxy-1,3-benzothiazol-2-yl)-(2-nitrobenzoyl)amino]ethyl-dimethylazanium (PubChem CID 7507376) has the molecular formula C19H21N4O4S+ and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-[(6-methoxy-1,3-benzothiazol-2-yl)-(2-nitrobenzoyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(6-methoxy-1,3-benzothiazol-2-yl)-(2-nitrobenzoyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7507376 |
| Molecular Formula | C19H21N4O4S+ |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[(6-methoxy-1,3-benzothiazol-2-yl)-(2-nitrobenzoyl)amino]ethyl-dimethylazanium |
| SMILES | COc1ccc2nc(N(CC[NH+](C)C)C(=O)c3ccccc3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C19H20N4O4S/c1-21(2)10-11-22(18(24)14-6-4-5-7-16(14)23(25)26)19-20-15-9-8-13(27-3)12-17(15)28-19/h4-9,12H,10-11H2,1-3H3/p+1 |
| InChIKey | SWJAGIMYHGKZNB-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|