C19H21N4O3S2+ — CID 7580232
dimethyl-[2-[(2-methylsulfanylbenzoyl)-(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]azanium (PubChem CID 7580232) has the molecular formula C19H21N4O3S2+ and a molecular weight of 417.54 g/mol. Its IUPAC name is dimethyl-[2-[(2-methylsulfanylbenzoyl)-(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[(2-methylsulfanylbenzoyl)-(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7580232 |
| Molecular Formula | C19H21N4O3S2+ |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | dimethyl-[2-[(2-methylsulfanylbenzoyl)-(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]azanium |
| SMILES | CSc1ccccc1C(=O)N(CC[NH+](C)C)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C19H20N4O3S2/c1-21(2)10-11-22(18(24)14-6-4-5-7-16(14)27-3)19-20-15-9-8-13(23(25)26)12-17(15)28-19/h4-9,12H,10-11H2,1-3H3/p+1 |
| InChIKey | QYIMQKONKIHZSO-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|