C18H21N4O4S+ — CID 7507706
2-[(6-ethyl-1,3-benzothiazol-2-yl)-(5-nitrofuran-2-carbonyl)amino]ethyl-dimethylazanium (PubChem CID 7507706) has the molecular formula C18H21N4O4S+ and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[(6-ethyl-1,3-benzothiazol-2-yl)-(5-nitrofuran-2-carbonyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(6-ethyl-1,3-benzothiazol-2-yl)-(5-nitrofuran-2-carbonyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7507706 |
| Molecular Formula | C18H21N4O4S+ |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[(6-ethyl-1,3-benzothiazol-2-yl)-(5-nitrofuran-2-carbonyl)amino]ethyl-dimethylazanium |
| SMILES | CCc1ccc2nc(N(CC[NH+](C)C)C(=O)c3ccc([N+](=O)[O-])o3)sc2c1 |
| InChI | InChI=1S/C18H20N4O4S/c1-4-12-5-6-13-15(11-12)27-18(19-13)21(10-9-20(2)3)17(23)14-7-8-16(26-14)22(24)25/h5-8,11H,4,9-10H2,1-3H3/p+1 |
| InChIKey | GDUVQMGVCLIPIE-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|