C17H19N4O5S+ — CID 7507353
2-[(6-methoxy-1,3-benzothiazol-2-yl)-(5-nitrofuran-2-carbonyl)amino]ethyl-dimethylazanium (PubChem CID 7507353) has the molecular formula C17H19N4O5S+ and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[(6-methoxy-1,3-benzothiazol-2-yl)-(5-nitrofuran-2-carbonyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(6-methoxy-1,3-benzothiazol-2-yl)-(5-nitrofuran-2-carbonyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7507353 |
| Molecular Formula | C17H19N4O5S+ |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-[(6-methoxy-1,3-benzothiazol-2-yl)-(5-nitrofuran-2-carbonyl)amino]ethyl-dimethylazanium |
| SMILES | COc1ccc2nc(N(CC[NH+](C)C)C(=O)c3ccc([N+](=O)[O-])o3)sc2c1 |
| InChI | InChI=1S/C17H18N4O5S/c1-19(2)8-9-20(16(22)13-6-7-15(26-13)21(23)24)17-18-12-5-4-11(25-3)10-14(12)27-17/h4-7,10H,8-9H2,1-3H3/p+1 |
| InChIKey | CNGLGOHOCCHUAL-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|