C23H30N3O3S+ — CID 7507341
2-[(4-butoxybenzoyl)-(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl-dimethylazanium (PubChem CID 7507341) has the molecular formula C23H30N3O3S+ and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[(4-butoxybenzoyl)-(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(4-butoxybenzoyl)-(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7507341 |
| Molecular Formula | C23H30N3O3S+ |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[(4-butoxybenzoyl)-(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl-dimethylazanium |
| SMILES | CCCCOc1ccc(C(=O)N(CC[NH+](C)C)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C23H29N3O3S/c1-5-6-15-29-18-9-7-17(8-10-18)22(27)26(14-13-25(2)3)23-24-20-12-11-19(28-4)16-21(20)30-23/h7-12,16H,5-6,13-15H2,1-4H3/p+1 |
| InChIKey | IMVHNNUFSOJRHX-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 56.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|