C19H15N3O6S3 — CID 41363521
N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-5-nitro-N-(2-thiophen-2-ylethyl)furan-2-carboxamide (PubChem CID 41363521) has the molecular formula C19H15N3O6S3 and a molecular weight of 477.55 g/mol. Its IUPAC name is N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-5-nitro-N-(2-thiophen-2-ylethyl)furan-2-carboxamide.
| Compound Name | N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-5-nitro-N-(2-thiophen-2-ylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 41363521 |
| Molecular Formula | C19H15N3O6S3 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-5-nitro-N-(2-thiophen-2-ylethyl)furan-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc2nc(N(CCc3cccs3)C(=O)c3ccc([N+](=O)[O-])o3)sc2c1 |
| InChI | InChI=1S/C19H15N3O6S3/c1-31(26,27)13-4-5-14-16(11-13)30-19(20-14)21(9-8-12-3-2-10-29-12)18(23)15-6-7-17(28-15)22(24)25/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | HAXBHCANOPGNFS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 123.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|