C18H24N4O4 — CID 171502756
5-amino-2-hydroxy-1-(3-hydroxypropyl)-4-methyl-6-oxopyridine-3-carbonitrile;2-(4-aminophenyl)ethanol (PubChem CID 171502756) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 5-amino-2-hydroxy-1-(3-hydroxypropyl)-4-methyl-6-oxopyridine-3-carbonitrile;2-(4-aminophenyl)ethanol.
| Compound Name | 5-amino-2-hydroxy-1-(3-hydroxypropyl)-4-methyl-6-oxopyridine-3-carbonitrile;2-(4-aminophenyl)ethanol |
|---|---|
| PubChem CID | 171502756 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 5-amino-2-hydroxy-1-(3-hydroxypropyl)-4-methyl-6-oxopyridine-3-carbonitrile;2-(4-aminophenyl)ethanol |
| SMILES | Cc1c(C#N)c(O)n(CCCO)c(=O)c1N.Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C10H13N3O3.C8H11NO/c1-6-7(5-11)9(15)13(3-2-4-14)10(16)8(6)12;9-8-3-1-7(2-4-8)5-6-10/h14-15H,2-4,12H2,1H3;1-4,10H,5-6,9H2 |
| InChIKey | ORCCXXSXSCTPKG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 158.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|